
CAS:144432-85-9|3-Chloro-4-fluorophenylboronic Acid
Molecular Formula:C6H5BClFO2
Molecular Weight:174.37 g/mol
Purity:97 percent
Package:100g/250g/500g/1kg/bulk package
- Världsomfattande leverans
- Kvalitetssäkring
- 24/7 kundservice
produkt introduktion
3-Chloro-4-fluorophenylboronic acid has a wide range of applications in scientific research. It is used as a reagent in the synthesis of various compounds, including pharmaceuticals, agrochemicals, and other organic compounds. It is also used in the synthesis of polymers and other materials. Additionally, it is used as a catalyst in organic reactions, including the synthesis of polymers and other materials. Furthermore, 3-Chloro-4-fluorophenylboronic acid is used in the synthesis of fluorescent probes for biological imaging.
|
|
|
| (3-chloro-4-fluorophenyl)boronic acid | |
| MFCD00051800 | |
| Off-white to faintly orange powder | |
| 1.41 g/cm3 | |
| 306ºC at 760 mmHg | |
| 260-262ºC | |
| 138.8ºC | |
| 40.46 | |
| 0.16 | |
| InChI=1S/C6H5BClFO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,10-11H | |
| WJDZZXIDQYKVDG-UHFFFAOYSA-N |

Populära Taggar: cas:144432-85-9|3-chloro-4-fluorophenylboronic acid, price, quotation, discount, in stock, for sale




![CAS:250726-93-3|2-(2,3-Dihydrotieno[3,4-b][1,4]dioxin-5-yl)-4,4,5,{{12 }}tetrametyl-1,3,2-dioxaborolan](/uploads/202235855/small/cas-250726-93-3-2-2-3-dihydrothieno-3-4-b-1a297511a2-2258-4ea7-8a97-c14384487b31.jpg?size=384x0)

